C27H31NO6 — CID 4706096
1-(4-butoxy-3-ethoxyphenyl)-2-(2-methoxyethyl)-7-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4706096) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is 1-(4-butoxy-3-ethoxyphenyl)-2-(2-methoxyethyl)-7-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-butoxy-3-ethoxyphenyl)-2-(2-methoxyethyl)-7-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4706096 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-(4-butoxy-3-ethoxyphenyl)-2-(2-methoxyethyl)-7-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4ccc(C)cc4c3=O)C(=O)N2CCOC)cc1OCC |
| InChI | InChI=1S/C27H31NO6/c1-5-7-13-33-21-11-9-18(16-22(21)32-6-2)24-23-25(29)19-15-17(3)8-10-20(19)34-26(23)27(30)28(24)12-14-31-4/h8-11,15-16,24H,5-7,12-14H2,1-4H3 |
| InChIKey | FKDJRXCBXWDEIO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|