C19H27NO5S2 — CID 47061219
4-(2-butoxyethylsulfonylmethyl)-2-(4-ethoxy-3-methoxyphenyl)-1,3-thiazole (PubChem CID 47061219) has the molecular formula C19H27NO5S2 and a molecular weight of 413.56 g/mol. Its IUPAC name is 4-(2-butoxyethylsulfonylmethyl)-2-(4-ethoxy-3-methoxyphenyl)-1,3-thiazole.
| Compound Name | 4-(2-butoxyethylsulfonylmethyl)-2-(4-ethoxy-3-methoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 47061219 |
| Molecular Formula | C19H27NO5S2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 4-(2-butoxyethylsulfonylmethyl)-2-(4-ethoxy-3-methoxyphenyl)-1,3-thiazole |
| SMILES | CCCCOCCS(=O)(=O)Cc1csc(-c2ccc(OCC)c(OC)c2)n1 |
| InChI | InChI=1S/C19H27NO5S2/c1-4-6-9-24-10-11-27(21,22)14-16-13-26-19(20-16)15-7-8-17(25-5-2)18(12-15)23-3/h7-8,12-13H,4-6,9-11,14H2,1-3H3 |
| InChIKey | YPWYLYBNWGZVTN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|