C21H27N3O2 — CID 47064281
N-(2,5-dimethylphenyl)-2-[2-(4-hydroxypiperidin-1-yl)anilino]acetamide (PubChem CID 47064281) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[2-(4-hydroxypiperidin-1-yl)anilino]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[2-(4-hydroxypiperidin-1-yl)anilino]acetamide |
|---|---|
| PubChem CID | 47064281 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[2-(4-hydroxypiperidin-1-yl)anilino]acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CNc2ccccc2N2CCC(O)CC2)c1 |
| InChI | InChI=1S/C21H27N3O2/c1-15-7-8-16(2)19(13-15)23-21(26)14-22-18-5-3-4-6-20(18)24-11-9-17(25)10-12-24/h3-8,13,17,22,25H,9-12,14H2,1-2H3,(H,23,26) |
| InChIKey | KYCQQFNUYWHFIC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |