C19H25N3O4S — CID 47066182
N-[(2-cyclopentyloxyphenyl)methyl]-1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxamide (PubChem CID 47066182) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[(2-cyclopentyloxyphenyl)methyl]-1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxamide.
| Compound Name | N-[(2-cyclopentyloxyphenyl)methyl]-1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 47066182 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[(2-cyclopentyloxyphenyl)methyl]-1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NCc2ccccc2OC2CCCC2)n(C)c1 |
| InChI | InChI=1S/C19H25N3O4S/c1-20-27(24,25)16-11-17(22(2)13-16)19(23)21-12-14-7-3-6-10-18(14)26-15-8-4-5-9-15/h3,6-7,10-11,13,15,20H,4-5,8-9,12H2,1-2H3,(H,21,23) |
| InChIKey | JZHNVVQWNZEYIL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |