C18H24F4N2O2 — CID 47070110
N-[(4-fluorophenyl)methyl]-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-4-carboxamide (PubChem CID 47070110) has the molecular formula C18H24F4N2O2 and a molecular weight of 376.39 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 47070110 |
| Molecular Formula | C18H24F4N2O2 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C1CCN(CCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H24F4N2O2/c19-16-4-2-14(3-5-16)12-23-17(25)15-6-9-24(10-7-15)8-1-11-26-13-18(20,21)22/h2-5,15H,1,6-13H2,(H,23,25) |
| InChIKey | NNDJAAJUUWJINP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|