C19H24N4O4 — CID 47073138
1-(1-adamantyl)-3-[(5-propyl-1,2,4-oxadiazol-3-yl)methyl]imidazolidine-2,4,5-trione (PubChem CID 47073138) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(5-propyl-1,2,4-oxadiazol-3-yl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-(1-adamantyl)-3-[(5-propyl-1,2,4-oxadiazol-3-yl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 47073138 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-(1-adamantyl)-3-[(5-propyl-1,2,4-oxadiazol-3-yl)methyl]imidazolidine-2,4,5-trione |
| SMILES | CCCc1nc(CN2C(=O)C(=O)N(C34CC5CC(CC(C5)C3)C4)C2=O)no1 |
| InChI | InChI=1S/C19H24N4O4/c1-2-3-15-20-14(21-27-15)10-22-16(24)17(25)23(18(22)26)19-7-11-4-12(8-19)6-13(5-11)9-19/h11-13H,2-10H2,1H3 |
| InChIKey | SSLKDRRQUVRYBX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|