C22H24N4O6S — CID 47074202
4-(3,6-dioxodiazinan-1-yl)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzamide (PubChem CID 47074202) has the molecular formula C22H24N4O6S and a molecular weight of 472.52 g/mol. Its IUPAC name is 4-(3,6-dioxodiazinan-1-yl)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzamide.
| Compound Name | 4-(3,6-dioxodiazinan-1-yl)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 47074202 |
| Molecular Formula | C22H24N4O6S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 4-(3,6-dioxodiazinan-1-yl)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(N3NC(=O)CCC3=O)cc2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H24N4O6S/c1-15-2-5-17(14-19(15)33(30,31)25-10-12-32-13-11-25)23-22(29)16-3-6-18(7-4-16)26-21(28)9-8-20(27)24-26/h2-7,14H,8-13H2,1H3,(H,23,29)(H,24,27) |
| InChIKey | JXBVJJSBNIKZFK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |