C16H22ClN3O2 — CID 47075143
2-(2-chlorophenyl)-N'-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]ethanimidamide (PubChem CID 47075143) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N'-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]ethanimidamide.
| Compound Name | 2-(2-chlorophenyl)-N'-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]ethanimidamide |
|---|---|
| PubChem CID | 47075143 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-(2-chlorophenyl)-N'-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]ethanimidamide |
| SMILES | CC1CCN(C(=O)CO/N=C(/N)Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C16H22ClN3O2/c1-12-6-8-20(9-7-12)16(21)11-22-19-15(18)10-13-4-2-3-5-14(13)17/h2-5,12H,6-11H2,1H3,(H2,18,19) |
| InChIKey | UEGSQKFNPWASOX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|