C16H18BrN3O3S — CID 47075434
3-[(5-bromo-2-methylphenyl)sulfonylamino]-N-(6-methyl-2-pyridinyl)propanamide (PubChem CID 47075434) has the molecular formula C16H18BrN3O3S and a molecular weight of 412.31 g/mol. Its IUPAC name is 3-[(5-bromo-2-methylphenyl)sulfonylamino]-N-(6-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[(5-bromo-2-methylphenyl)sulfonylamino]-N-(6-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 47075434 |
| Molecular Formula | C16H18BrN3O3S |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 3-[(5-bromo-2-methylphenyl)sulfonylamino]-N-(6-methyl-2-pyridinyl)propanamide |
| SMILES | Cc1cccc(NC(=O)CCNS(=O)(=O)c2cc(Br)ccc2C)n1 |
| InChI | InChI=1S/C16H18BrN3O3S/c1-11-6-7-13(17)10-14(11)24(22,23)18-9-8-16(21)20-15-5-3-4-12(2)19-15/h3-7,10,18H,8-9H2,1-2H3,(H,19,20,21) |
| InChIKey | PSLZRYGDONZYNC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |