C20H33N3O2 — CID 47075746
1-(cyclohexylmethyl)-1-[2-(dimethylamino)ethyl]-3-[(2-methoxyphenyl)methyl]urea (PubChem CID 47075746) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-1-[2-(dimethylamino)ethyl]-3-[(2-methoxyphenyl)methyl]urea.
| Compound Name | 1-(cyclohexylmethyl)-1-[2-(dimethylamino)ethyl]-3-[(2-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 47075746 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 1-(cyclohexylmethyl)-1-[2-(dimethylamino)ethyl]-3-[(2-methoxyphenyl)methyl]urea |
| SMILES | COc1ccccc1CNC(=O)N(CCN(C)C)CC1CCCCC1 |
| InChI | InChI=1S/C20H33N3O2/c1-22(2)13-14-23(16-17-9-5-4-6-10-17)20(24)21-15-18-11-7-8-12-19(18)25-3/h7-8,11-12,17H,4-6,9-10,13-16H2,1-3H3,(H,21,24) |
| InChIKey | BNRBLPNSIDUPGS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |