C22H32N4O3 — CID 47077854
tert-butyl N-[2-[5-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-1,2,4-oxadiazol-3-yl]propan-2-yl]carbamate (PubChem CID 47077854) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is tert-butyl N-[2-[5-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-1,2,4-oxadiazol-3-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-[5-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-1,2,4-oxadiazol-3-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 47077854 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | tert-butyl N-[2-[5-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-1,2,4-oxadiazol-3-yl]propan-2-yl]carbamate |
| SMILES | CN(Cc1nc(C(C)(C)NC(=O)OC(C)(C)C)no1)C1CCCc2ccccc21 |
| InChI | InChI=1S/C22H32N4O3/c1-21(2,3)28-20(27)24-22(4,5)19-23-18(29-25-19)14-26(6)17-13-9-11-15-10-7-8-12-16(15)17/h7-8,10,12,17H,9,11,13-14H2,1-6H3,(H,24,27) |
| InChIKey | GLXBVHCNGFAWKY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |