C15H22F2N2O3S — CID 47077896
2-[butyl(ethyl)amino]-N-[2-(difluoromethylsulfonyl)phenyl]acetamide (PubChem CID 47077896) has the molecular formula C15H22F2N2O3S and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-[butyl(ethyl)amino]-N-[2-(difluoromethylsulfonyl)phenyl]acetamide.
| Compound Name | 2-[butyl(ethyl)amino]-N-[2-(difluoromethylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 47077896 |
| Molecular Formula | C15H22F2N2O3S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-[butyl(ethyl)amino]-N-[2-(difluoromethylsulfonyl)phenyl]acetamide |
| SMILES | CCCCN(CC)CC(=O)Nc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C15H22F2N2O3S/c1-3-5-10-19(4-2)11-14(20)18-12-8-6-7-9-13(12)23(21,22)15(16)17/h6-9,15H,3-5,10-11H2,1-2H3,(H,18,20) |
| InChIKey | KGEKDAJVEWUMLG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |