C14H16BrNO4 — CID 47078542
N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-(oxolan-2-yl)acetamide (PubChem CID 47078542) has the molecular formula C14H16BrNO4 and a molecular weight of 342.19 g/mol. Its IUPAC name is N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-(oxolan-2-yl)acetamide.
| Compound Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-(oxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 47078542 |
| Molecular Formula | C14H16BrNO4 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-(oxolan-2-yl)acetamide |
| SMILES | O=C(CC1CCCO1)NCc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C14H16BrNO4/c15-11-4-9(5-12-14(11)20-8-19-12)7-16-13(17)6-10-2-1-3-18-10/h4-5,10H,1-3,6-8H2,(H,16,17) |
| InChIKey | ZNWXVURRXUMZTM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |