C25H19N3O7S — CID 4707919
methyl 2-[6,7-dimethyl-1-(4-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4707919) has the molecular formula C25H19N3O7S and a molecular weight of 505.51 g/mol. Its IUPAC name is methyl 2-[6,7-dimethyl-1-(4-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[6,7-dimethyl-1-(4-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4707919 |
| Molecular Formula | C25H19N3O7S |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | methyl 2-[6,7-dimethyl-1-(4-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)c3oc4cc(C)c(C)cc4c(=O)c3C2c2ccc([N+](=O)[O-])cc2)nc1C |
| InChI | InChI=1S/C25H19N3O7S/c1-11-9-16-17(10-12(11)2)35-21-18(20(16)29)19(14-5-7-15(8-6-14)28(32)33)27(23(21)30)25-26-13(3)22(36-25)24(31)34-4/h5-10,19H,1-4H3 |
| InChIKey | XXUPKDCGLILNPG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 132.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|