C26H21N3O7S — CID 4707909
ethyl 2-[6,7-dimethyl-1-(3-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4707909) has the molecular formula C26H21N3O7S and a molecular weight of 519.54 g/mol. Its IUPAC name is ethyl 2-[6,7-dimethyl-1-(3-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[6,7-dimethyl-1-(3-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4707909 |
| Molecular Formula | C26H21N3O7S |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | ethyl 2-[6,7-dimethyl-1-(3-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2C(=O)c3oc4cc(C)c(C)cc4c(=O)c3C2c2cccc([N+](=O)[O-])c2)nc1C |
| InChI | InChI=1S/C26H21N3O7S/c1-5-35-25(32)23-14(4)27-26(37-23)28-20(15-7-6-8-16(11-15)29(33)34)19-21(30)17-9-12(2)13(3)10-18(17)36-22(19)24(28)31/h6-11,20H,5H2,1-4H3 |
| InChIKey | KBHIOYXDZJREKW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 132.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|