C25H16FN3O7S — CID 4708201
prop-2-enyl 2-[7-fluoro-1-(3-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4708201) has the molecular formula C25H16FN3O7S and a molecular weight of 521.48 g/mol. Its IUPAC name is prop-2-enyl 2-[7-fluoro-1-(3-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[7-fluoro-1-(3-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4708201 |
| Molecular Formula | C25H16FN3O7S |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | prop-2-enyl 2-[7-fluoro-1-(3-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)c3oc4ccc(F)cc4c(=O)c3C2c2cccc([N+](=O)[O-])c2)nc1C |
| InChI | InChI=1S/C25H16FN3O7S/c1-3-9-35-24(32)22-12(2)27-25(37-22)28-19(13-5-4-6-15(10-13)29(33)34)18-20(30)16-11-14(26)7-8-17(16)36-21(18)23(28)31/h3-8,10-11,19H,1,9H2,2H3 |
| InChIKey | JOMCMYGZLYWWPO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 132.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|