C18H27N5O — CID 47080116
6-(diethylamino)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyridine-3-carboxamide (PubChem CID 47080116) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is 6-(diethylamino)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyridine-3-carboxamide.
| Compound Name | 6-(diethylamino)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47080116 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 6-(diethylamino)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyridine-3-carboxamide |
| SMILES | CCN(CC)c1ccc(C(=O)NCCCn2nc(C)cc2C)cn1 |
| InChI | InChI=1S/C18H27N5O/c1-5-22(6-2)17-9-8-16(13-20-17)18(24)19-10-7-11-23-15(4)12-14(3)21-23/h8-9,12-13H,5-7,10-11H2,1-4H3,(H,19,24) |
| InChIKey | LNMRFKKFDVILPL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|