C32H32N2O7S — CID 4708028
prop-2-enyl 2-[1-(4-butoxy-3-methoxyphenyl)-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4708028) has the molecular formula C32H32N2O7S and a molecular weight of 588.68 g/mol. Its IUPAC name is prop-2-enyl 2-[1-(4-butoxy-3-methoxyphenyl)-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[1-(4-butoxy-3-methoxyphenyl)-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4708028 |
| Molecular Formula | C32H32N2O7S |
| Molecular Weight | 588.68 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | prop-2-enyl 2-[1-(4-butoxy-3-methoxyphenyl)-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)c3oc4cc(C)c(C)cc4c(=O)c3C2c2ccc(OCCCC)c(OC)c2)nc1C |
| InChI | InChI=1S/C32H32N2O7S/c1-7-9-13-39-22-11-10-20(16-24(22)38-6)26-25-27(35)21-14-17(3)18(4)15-23(21)41-28(25)30(36)34(26)32-33-19(5)29(42-32)31(37)40-12-8-2/h8,10-11,14-16,26H,2,7,9,12-13H2,1,3-6H3 |
| InChIKey | LWXCVXKQBRLHFY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 108.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.68 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|