C31H29ClN2O7S — CID 4708684
prop-2-enyl 2-[1-(4-butoxy-3-ethoxyphenyl)-7-chloro-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4708684) has the molecular formula C31H29ClN2O7S and a molecular weight of 609.10 g/mol. Its IUPAC name is prop-2-enyl 2-[1-(4-butoxy-3-ethoxyphenyl)-7-chloro-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[1-(4-butoxy-3-ethoxyphenyl)-7-chloro-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4708684 |
| Molecular Formula | C31H29ClN2O7S |
| Molecular Weight | 609.10 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | prop-2-enyl 2-[1-(4-butoxy-3-ethoxyphenyl)-7-chloro-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)c3oc4ccc(Cl)cc4c(=O)c3C2c2ccc(OCCCC)c(OCC)c2)nc1C |
| InChI | InChI=1S/C31H29ClN2O7S/c1-5-8-14-39-22-11-9-18(15-23(22)38-7-3)25-24-26(35)20-16-19(32)10-12-21(20)41-27(24)29(36)34(25)31-33-17(4)28(42-31)30(37)40-13-6-2/h6,9-12,15-16,25H,2,5,7-8,13-14H2,1,3-4H3 |
| InChIKey | SVWKUYYWYQQPKZ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 108.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.10 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|