C17H17F3N2O2S — CID 47081512
N-[2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-(pyridin-4-ylmethylsulfanyl)acetamide (PubChem CID 47081512) has the molecular formula C17H17F3N2O2S and a molecular weight of 370.40 g/mol. Its IUPAC name is N-[2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-(pyridin-4-ylmethylsulfanyl)acetamide.
| Compound Name | N-[2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-(pyridin-4-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 47081512 |
| Molecular Formula | C17H17F3N2O2S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-[2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-2-(pyridin-4-ylmethylsulfanyl)acetamide |
| SMILES | O=C(CSCc1ccncc1)NCC(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H17F3N2O2S/c18-17(19,20)14-4-2-1-3-13(14)15(23)9-22-16(24)11-25-10-12-5-7-21-8-6-12/h1-8,15,23H,9-11H2,(H,22,24) |
| InChIKey | FSWUYWNMRZYQPY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |