C28H29N3O4 — CID 47082214
tert-butyl N-methyl-N-[[2-[[2-(9-oxoacridin-10-yl)acetyl]amino]phenyl]methyl]carbamate (PubChem CID 47082214) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[[2-[[2-(9-oxoacridin-10-yl)acetyl]amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[[2-[[2-(9-oxoacridin-10-yl)acetyl]amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 47082214 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | tert-butyl N-methyl-N-[[2-[[2-(9-oxoacridin-10-yl)acetyl]amino]phenyl]methyl]carbamate |
| SMILES | CN(Cc1ccccc1NC(=O)Cn1c2ccccc2c(=O)c2ccccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H29N3O4/c1-28(2,3)35-27(34)30(4)17-19-11-5-8-14-22(19)29-25(32)18-31-23-15-9-6-12-20(23)26(33)21-13-7-10-16-24(21)31/h5-16H,17-18H2,1-4H3,(H,29,32) |
| InChIKey | ULMKLIHSVNGXNY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|