C19H30N2O3 — CID 60595393
tert-butyl N-methyl-N-[[2-(4-methylpentanoylamino)phenyl]methyl]carbamate (PubChem CID 60595393) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[[2-(4-methylpentanoylamino)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[[2-(4-methylpentanoylamino)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 60595393 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | tert-butyl N-methyl-N-[[2-(4-methylpentanoylamino)phenyl]methyl]carbamate |
| SMILES | CC(C)CCC(=O)Nc1ccccc1CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N2O3/c1-14(2)11-12-17(22)20-16-10-8-7-9-15(16)13-21(6)18(23)24-19(3,4)5/h7-10,14H,11-13H2,1-6H3,(H,20,22) |
| InChIKey | KVPUOLSNBYFWCX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |