C25H25N3O3 — CID 47084885
1-[4-(2-phenoxybenzoyl)-1,4-diazepan-1-yl]-2-pyridin-2-ylethanone (PubChem CID 47084885) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-[4-(2-phenoxybenzoyl)-1,4-diazepan-1-yl]-2-pyridin-2-ylethanone.
| Compound Name | 1-[4-(2-phenoxybenzoyl)-1,4-diazepan-1-yl]-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 47084885 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-[4-(2-phenoxybenzoyl)-1,4-diazepan-1-yl]-2-pyridin-2-ylethanone |
| SMILES | O=C(Cc1ccccn1)N1CCCN(C(=O)c2ccccc2Oc2ccccc2)CC1 |
| InChI | InChI=1S/C25H25N3O3/c29-24(19-20-9-6-7-14-26-20)27-15-8-16-28(18-17-27)25(30)22-12-4-5-13-23(22)31-21-10-2-1-3-11-21/h1-7,9-14H,8,15-19H2 |
| InChIKey | LGYDZCKSLQTKCZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |