C18H23N3O4 — CID 47087995
N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-(2-methoxyethoxy)pyridine-3-carboxamide (PubChem CID 47087995) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-(2-methoxyethoxy)pyridine-3-carboxamide.
| Compound Name | N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-(2-methoxyethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47087995 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-(2-methoxyethoxy)pyridine-3-carboxamide |
| SMILES | COCCOc1ncccc1C(=O)NCc1ncc(C)c(OC)c1C |
| InChI | InChI=1S/C18H23N3O4/c1-12-10-20-15(13(2)16(12)24-4)11-21-17(22)14-6-5-7-19-18(14)25-9-8-23-3/h5-7,10H,8-9,11H2,1-4H3,(H,21,22) |
| InChIKey | KBKRQGYYKXKXNF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|