C21H22N4O3 — CID 47092744
1-(furan-2-ylmethyl)-5-oxo-N-[2-(1-phenylpyrazol-3-yl)ethyl]pyrrolidine-3-carboxamide (PubChem CID 47092744) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-5-oxo-N-[2-(1-phenylpyrazol-3-yl)ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(furan-2-ylmethyl)-5-oxo-N-[2-(1-phenylpyrazol-3-yl)ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 47092744 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-(furan-2-ylmethyl)-5-oxo-N-[2-(1-phenylpyrazol-3-yl)ethyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCc1ccn(-c2ccccc2)n1)C1CC(=O)N(Cc2ccco2)C1 |
| InChI | InChI=1S/C21H22N4O3/c26-20-13-16(14-24(20)15-19-7-4-12-28-19)21(27)22-10-8-17-9-11-25(23-17)18-5-2-1-3-6-18/h1-7,9,11-12,16H,8,10,13-15H2,(H,22,27) |
| InChIKey | SCMISBSXNUIXIK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |