C21H25N5O3 — CID 95859560
(3S)-1-(furan-2-ylmethyl)-5-oxo-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]pyrrolidine-3-carboxamide (PubChem CID 95859560) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is (3S)-1-(furan-2-ylmethyl)-5-oxo-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(furan-2-ylmethyl)-5-oxo-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95859560 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (3S)-1-(furan-2-ylmethyl)-5-oxo-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCCCc1nnc2ccccn12)[C@H]1CC(=O)N(Cc2ccco2)C1 |
| InChI | InChI=1S/C21H25N5O3/c27-20-13-16(14-25(20)15-17-7-6-12-29-17)21(28)22-10-4-1-2-8-18-23-24-19-9-3-5-11-26(18)19/h3,5-7,9,11-12,16H,1-2,4,8,10,13-15H2,(H,22,28)/t16-/m0/s1 |
| InChIKey | AGKSUTSDAOVPCL-INIZCTEOSA-N |
| XLogP | 2.20 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|