C20H18F3N5O2 — CID 86207232
5-oxo-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 86207232) has the molecular formula C20H18F3N5O2 and a molecular weight of 417.39 g/mol. Its IUPAC name is 5-oxo-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 86207232 |
| Molecular Formula | C20H18F3N5O2 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 5-oxo-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCc1nnc2ccccn12)C1CC(=O)N(c2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C20H18F3N5O2/c21-14-9-13(10-15(22)19(14)23)28-11-12(8-18(28)29)20(30)24-6-3-5-17-26-25-16-4-1-2-7-27(16)17/h1-2,4,7,9-10,12H,3,5-6,8,11H2,(H,24,30) |
| InChIKey | XRIWPMIMILAYOE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|