C16H27N5O2 — CID 47093320
2-cyclohexyl-N-[2-[(2,5-dimethylpyrazol-3-yl)carbamoylamino]ethyl]acetamide (PubChem CID 47093320) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-[(2,5-dimethylpyrazol-3-yl)carbamoylamino]ethyl]acetamide.
| Compound Name | 2-cyclohexyl-N-[2-[(2,5-dimethylpyrazol-3-yl)carbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 47093320 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 2-cyclohexyl-N-[2-[(2,5-dimethylpyrazol-3-yl)carbamoylamino]ethyl]acetamide |
| SMILES | Cc1cc(NC(=O)NCCNC(=O)CC2CCCCC2)n(C)n1 |
| InChI | InChI=1S/C16H27N5O2/c1-12-10-14(21(2)20-12)19-16(23)18-9-8-17-15(22)11-13-6-4-3-5-7-13/h10,13H,3-9,11H2,1-2H3,(H,17,22)(H2,18,19,23) |
| InChIKey | MCQQXANLKMDMNV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|