C9H14N4O — CID 115581841
1-cyclopropyl-3-(2,5-dimethylpyrazol-3-yl)urea (PubChem CID 115581841) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,5-dimethylpyrazol-3-yl)urea.
| Compound Name | 1-cyclopropyl-3-(2,5-dimethylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 115581841 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 1-cyclopropyl-3-(2,5-dimethylpyrazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)NC2CC2)n(C)n1 |
| InChI | InChI=1S/C9H14N4O/c1-6-5-8(13(2)12-6)11-9(14)10-7-3-4-7/h5,7H,3-4H2,1-2H3,(H2,10,11,14) |
| InChIKey | JFPHMTDEFLCYNK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |