C8H13N3O2 — CID 130679371
N-(2,5-dimethylpyrazol-3-yl)-2-hydroxypropanamide (PubChem CID 130679371) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is N-(2,5-dimethylpyrazol-3-yl)-2-hydroxypropanamide.
| Compound Name | N-(2,5-dimethylpyrazol-3-yl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 130679371 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-(2,5-dimethylpyrazol-3-yl)-2-hydroxypropanamide |
| SMILES | Cc1cc(NC(=O)C(C)O)n(C)n1 |
| InChI | InChI=1S/C8H13N3O2/c1-5-4-7(11(3)10-5)9-8(13)6(2)12/h4,6,12H,1-3H3,(H,9,13) |
| InChIKey | VYDBMSSAIZZBCR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |