C8H12ClN3O — CID 43180348
2-chloro-N-(2,5-dimethylpyrazol-3-yl)propanamide (PubChem CID 43180348) has the molecular formula C8H12ClN3O and a molecular weight of 201.66 g/mol. Its IUPAC name is 2-chloro-N-(2,5-dimethylpyrazol-3-yl)propanamide.
| Compound Name | 2-chloro-N-(2,5-dimethylpyrazol-3-yl)propanamide |
|---|---|
| PubChem CID | 43180348 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 2-chloro-N-(2,5-dimethylpyrazol-3-yl)propanamide |
| SMILES | Cc1cc(NC(=O)C(C)Cl)n(C)n1 |
| InChI | InChI=1S/C8H12ClN3O/c1-5-4-7(12(3)11-5)10-8(13)6(2)9/h4,6H,1-3H3,(H,10,13) |
| InChIKey | GHHOZQSLTYCSOD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|