C22H25N3O5 — CID 47094354
[1-(1H-indol-3-yl)-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate (PubChem CID 47094354) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is [1-(1H-indol-3-yl)-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate.
| Compound Name | [1-(1H-indol-3-yl)-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
|---|---|
| PubChem CID | 47094354 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [1-(1H-indol-3-yl)-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
| SMILES | CC(OC(=O)CCCN1C(=O)NC2(CCCC2)C1=O)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H25N3O5/c1-14(19(27)16-13-23-17-8-3-2-7-15(16)17)30-18(26)9-6-12-25-20(28)22(24-21(25)29)10-4-5-11-22/h2-3,7-8,13-14,23H,4-6,9-12H2,1H3,(H,24,29) |
| InChIKey | NACQVEDKSTWKMG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|