C15H18N2O2S — CID 47095161
3-(3-hydroxypropyl)-2-(2-methylprop-2-enylsulfanyl)quinazolin-4-one (PubChem CID 47095161) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-2-(2-methylprop-2-enylsulfanyl)quinazolin-4-one.
| Compound Name | 3-(3-hydroxypropyl)-2-(2-methylprop-2-enylsulfanyl)quinazolin-4-one |
|---|---|
| PubChem CID | 47095161 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-(3-hydroxypropyl)-2-(2-methylprop-2-enylsulfanyl)quinazolin-4-one |
| SMILES | C=C(C)CSc1nc2ccccc2c(=O)n1CCCO |
| InChI | InChI=1S/C15H18N2O2S/c1-11(2)10-20-15-16-13-7-4-3-6-12(13)14(19)17(15)8-5-9-18/h3-4,6-7,18H,1,5,8-10H2,2H3 |
| InChIKey | CCKUAOYAOTTWHS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|