C16H18N4O2S — CID 110902275
3-(3-hydroxypropyl)-2-(2-pyrazol-1-ylethylsulfanyl)quinazolin-4-one (PubChem CID 110902275) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-2-(2-pyrazol-1-ylethylsulfanyl)quinazolin-4-one.
| Compound Name | 3-(3-hydroxypropyl)-2-(2-pyrazol-1-ylethylsulfanyl)quinazolin-4-one |
|---|---|
| PubChem CID | 110902275 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-(3-hydroxypropyl)-2-(2-pyrazol-1-ylethylsulfanyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCCn2cccn2)n1CCCO |
| InChI | InChI=1S/C16H18N4O2S/c21-11-4-9-20-15(22)13-5-1-2-6-14(13)18-16(20)23-12-10-19-8-3-7-17-19/h1-3,5-8,21H,4,9-12H2 |
| InChIKey | IQLXKFWRZYENEA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |