C15H24N2OS — CID 47095623
N,N-bis(2-methylpropyl)-2-pyridin-2-ylsulfanylacetamide (PubChem CID 47095623) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-2-pyridin-2-ylsulfanylacetamide.
| Compound Name | N,N-bis(2-methylpropyl)-2-pyridin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 47095623 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N,N-bis(2-methylpropyl)-2-pyridin-2-ylsulfanylacetamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)CSc1ccccn1 |
| InChI | InChI=1S/C15H24N2OS/c1-12(2)9-17(10-13(3)4)15(18)11-19-14-7-5-6-8-16-14/h5-8,12-13H,9-11H2,1-4H3 |
| InChIKey | CDXUFJMYRMIUKP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |