C28H19N5O5S — CID 4709877
2-cyano-N-(furan-2-ylmethyl)-2-[5-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 4709877) has the molecular formula C28H19N5O5S and a molecular weight of 537.56 g/mol. Its IUPAC name is 2-cyano-N-(furan-2-ylmethyl)-2-[5-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | 2-cyano-N-(furan-2-ylmethyl)-2-[5-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 4709877 |
| Molecular Formula | C28H19N5O5S |
| Molecular Weight | 537.56 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 2-cyano-N-(furan-2-ylmethyl)-2-[5-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | N#CC(C(=O)NCc1ccco1)=c1sc(=Cc2cccn2-c2ccc([N+](=O)[O-])cc2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H19N5O5S/c29-17-24(26(34)30-18-23-9-5-15-38-23)28-32(20-6-2-1-3-7-20)27(35)25(39-28)16-22-8-4-14-31(22)19-10-12-21(13-11-19)33(36)37/h1-16H,18H2,(H,30,34) |
| InChIKey | PEBDBCUYXPAPBE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|