C28H18N4O6S — CID 6196713
(2Z)-2-cyano-N-(furan-2-ylmethyl)-2-[(5Z)-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 6196713) has the molecular formula C28H18N4O6S and a molecular weight of 538.54 g/mol. Its IUPAC name is (2Z)-2-cyano-N-(furan-2-ylmethyl)-2-[(5Z)-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | (2Z)-2-cyano-N-(furan-2-ylmethyl)-2-[(5Z)-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 6196713 |
| Molecular Formula | C28H18N4O6S |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | (2Z)-2-cyano-N-(furan-2-ylmethyl)-2-[(5Z)-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | N#C/C(C(=O)NCc1ccco1)=c1/s/c(=C\c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H18N4O6S/c29-16-23(26(33)30-17-22-7-4-14-37-22)28-31(19-5-2-1-3-6-19)27(34)25(39-28)15-21-12-13-24(38-21)18-8-10-20(11-9-18)32(35)36/h1-15H,17H2,(H,30,33)/b25-15-,28-23- |
| InChIKey | KHGRAEBDTWASOC-SYVFJETJSA-N |
| XLogP | 3.48 |
| TPSA | 144.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|