C14H15BrN2O2 — CID 47101356
N-[2-(2-bromoanilino)-2-oxoethyl]hexa-2,4-dienamide (PubChem CID 47101356) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is N-[2-(2-bromoanilino)-2-oxoethyl]hexa-2,4-dienamide.
| Compound Name | N-[2-(2-bromoanilino)-2-oxoethyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 47101356 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | N-[2-(2-bromoanilino)-2-oxoethyl]hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NCC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C14H15BrN2O2/c1-2-3-4-9-13(18)16-10-14(19)17-12-8-6-5-7-11(12)15/h2-9H,10H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | VQNQYRAOXGBWLB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|