C17H27NO2 — CID 4711987
N-[1-(2,3-dimethoxyphenyl)but-3-enyl]-2-methylbutan-2-amine (PubChem CID 4711987) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N-[1-(2,3-dimethoxyphenyl)but-3-enyl]-2-methylbutan-2-amine.
| Compound Name | N-[1-(2,3-dimethoxyphenyl)but-3-enyl]-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 4711987 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | N-[1-(2,3-dimethoxyphenyl)but-3-enyl]-2-methylbutan-2-amine |
| SMILES | C=CCC(NC(C)(C)CC)c1cccc(OC)c1OC |
| InChI | InChI=1S/C17H27NO2/c1-7-10-14(18-17(3,4)8-2)13-11-9-12-15(19-5)16(13)20-6/h7,9,11-12,14,18H,1,8,10H2,2-6H3 |
| InChIKey | UAYXOANXQUIPDQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|