C10H21NO2 — CID 4712138
N-(1,3-dioxepan-2-ylmethyl)-2-methylpropan-1-amine (PubChem CID 4712138) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is N-(1,3-dioxepan-2-ylmethyl)-2-methylpropan-1-amine.
| Compound Name | N-(1,3-dioxepan-2-ylmethyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 4712138 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | N-(1,3-dioxepan-2-ylmethyl)-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC1OCCCCO1 |
| InChI | InChI=1S/C10H21NO2/c1-9(2)7-11-8-10-12-5-3-4-6-13-10/h9-11H,3-8H2,1-2H3 |
| InChIKey | AEBZGLZVBBWGNE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |