C13H23N — CID 4712374
3-methyl-N,1-bis(prop-2-enyl)cyclohexan-1-amine (PubChem CID 4712374) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 3-methyl-N,1-bis(prop-2-enyl)cyclohexan-1-amine.
| Compound Name | 3-methyl-N,1-bis(prop-2-enyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 4712374 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 3-methyl-N,1-bis(prop-2-enyl)cyclohexan-1-amine |
| SMILES | C=CCNC1(CC=C)CCCC(C)C1 |
| InChI | InChI=1S/C13H23N/c1-4-8-13(14-10-5-2)9-6-7-12(3)11-13/h4-5,12,14H,1-2,6-11H2,3H3 |
| InChIKey | SPHXKRRTCKALHZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|