C13H24ClN — CID 107901067
1-(chloromethyl)-3-methyl-N-(3-methylbut-2-enyl)cyclohexan-1-amine (PubChem CID 107901067) has the molecular formula C13H24ClN and a molecular weight of 229.79 g/mol. Its IUPAC name is 1-(chloromethyl)-3-methyl-N-(3-methylbut-2-enyl)cyclohexan-1-amine.
| Compound Name | 1-(chloromethyl)-3-methyl-N-(3-methylbut-2-enyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 107901067 |
| Molecular Formula | C13H24ClN |
| Molecular Weight | 229.79 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 1-(chloromethyl)-3-methyl-N-(3-methylbut-2-enyl)cyclohexan-1-amine |
| SMILES | CC(C)=CCNC1(CCl)CCCC(C)C1 |
| InChI | InChI=1S/C13H24ClN/c1-11(2)6-8-15-13(10-14)7-4-5-12(3)9-13/h6,12,15H,4-5,7-10H2,1-3H3 |
| InChIKey | MARDBUATMZBZCF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|