C11H19ClF3N — CID 65030476
1-(chloromethyl)-3-methyl-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine (PubChem CID 65030476) has the molecular formula C11H19ClF3N and a molecular weight of 257.73 g/mol. Its IUPAC name is 1-(chloromethyl)-3-methyl-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine.
| Compound Name | 1-(chloromethyl)-3-methyl-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 65030476 |
| Molecular Formula | C11H19ClF3N |
| Molecular Weight | 257.73 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-(chloromethyl)-3-methyl-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine |
| SMILES | CC1CCCC(CCl)(NCCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H19ClF3N/c1-9-3-2-4-10(7-9,8-12)16-6-5-11(13,14)15/h9,16H,2-8H2,1H3 |
| InChIKey | BUTXZOJELYDZMW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|