C17H27NO4 — CID 4712392
2-[2-[1-(4-ethoxy-3-methoxyphenyl)but-3-enylamino]ethoxy]ethanol (PubChem CID 4712392) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-[2-[1-(4-ethoxy-3-methoxyphenyl)but-3-enylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[1-(4-ethoxy-3-methoxyphenyl)but-3-enylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 4712392 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-[2-[1-(4-ethoxy-3-methoxyphenyl)but-3-enylamino]ethoxy]ethanol |
| SMILES | C=CCC(NCCOCCO)c1ccc(OCC)c(OC)c1 |
| InChI | InChI=1S/C17H27NO4/c1-4-6-15(18-9-11-21-12-10-19)14-7-8-16(22-5-2)17(13-14)20-3/h4,7-8,13,15,18-19H,1,5-6,9-12H2,2-3H3 |
| InChIKey | KTDCHSKPPDFFME-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|