C14H12F2N2OS — CID 47126211
2-(3,4-difluorophenyl)sulfanyl-N-(5-methyl-2-pyridinyl)acetamide (PubChem CID 47126211) has the molecular formula C14H12F2N2OS and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfanyl-N-(5-methyl-2-pyridinyl)acetamide.
| Compound Name | 2-(3,4-difluorophenyl)sulfanyl-N-(5-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 47126211 |
| Molecular Formula | C14H12F2N2OS |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfanyl-N-(5-methyl-2-pyridinyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C14H12F2N2OS/c1-9-2-5-13(17-7-9)18-14(19)8-20-10-3-4-11(15)12(16)6-10/h2-7H,8H2,1H3,(H,17,18,19) |
| InChIKey | WECQUOFKEDPBEP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |