C13H13N3OS — CID 47128547
2-methylsulfanyl-N-(2-phenylpyrimidin-5-yl)acetamide (PubChem CID 47128547) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-methylsulfanyl-N-(2-phenylpyrimidin-5-yl)acetamide.
| Compound Name | 2-methylsulfanyl-N-(2-phenylpyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 47128547 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-methylsulfanyl-N-(2-phenylpyrimidin-5-yl)acetamide |
| SMILES | CSCC(=O)Nc1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C13H13N3OS/c1-18-9-12(17)16-11-7-14-13(15-8-11)10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,16,17) |
| InChIKey | BCMJUARPOYOPOY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |