C9H10BrF3N2OS — CID 47140135
1-[2-(5-bromothiophen-2-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 47140135) has the molecular formula C9H10BrF3N2OS and a molecular weight of 331.16 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 47140135 |
| Molecular Formula | C9H10BrF3N2OS |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCCc1ccc(Br)s1)NCC(F)(F)F |
| InChI | InChI=1S/C9H10BrF3N2OS/c10-7-2-1-6(17-7)3-4-14-8(16)15-5-9(11,12)13/h1-2H,3-5H2,(H2,14,15,16) |
| InChIKey | YGUAMQSNERTPAW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |