C12H16BrF3N2O2S — CID 78880341
1-[2-(5-bromothiophen-2-yl)ethyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]urea (PubChem CID 78880341) has the molecular formula C12H16BrF3N2O2S and a molecular weight of 389.24 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]urea.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]urea |
|---|---|
| PubChem CID | 78880341 |
| Molecular Formula | C12H16BrF3N2O2S |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]urea |
| SMILES | O=C(NCCCOCC(F)(F)F)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C12H16BrF3N2O2S/c13-10-3-2-9(21-10)4-6-18-11(19)17-5-1-7-20-8-12(14,15)16/h2-3H,1,4-8H2,(H2,17,18,19) |
| InChIKey | BNGNRXNDQRGRFU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|