C14H18N2O4 — CID 47141715
methyl 1-[(6-oxo-1H-pyridine-3-carbonyl)amino]cyclohexane-1-carboxylate (PubChem CID 47141715) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is methyl 1-[(6-oxo-1H-pyridine-3-carbonyl)amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[(6-oxo-1H-pyridine-3-carbonyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 47141715 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | methyl 1-[(6-oxo-1H-pyridine-3-carbonyl)amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)c2ccc(=O)[nH]c2)CCCCC1 |
| InChI | InChI=1S/C14H18N2O4/c1-20-13(19)14(7-3-2-4-8-14)16-12(18)10-5-6-11(17)15-9-10/h5-6,9H,2-4,7-8H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | VMJHFCLNZNXYFX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |