C12H11FN2O3 — CID 47153631
methyl 2-[(4-fluoro-1H-indole-2-carbonyl)amino]acetate (PubChem CID 47153631) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is methyl 2-[(4-fluoro-1H-indole-2-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(4-fluoro-1H-indole-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 47153631 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | methyl 2-[(4-fluoro-1H-indole-2-carbonyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cc2c(F)cccc2[nH]1 |
| InChI | InChI=1S/C12H11FN2O3/c1-18-11(16)6-14-12(17)10-5-7-8(13)3-2-4-9(7)15-10/h2-5,15H,6H2,1H3,(H,14,17) |
| InChIKey | FYUIFEQFIAGHFQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |